C25H32N3O2+ — CID 9041261
1-[(3R)-3-(4-benzhydrylpiperazin-4-ium-1-carbonyl)piperidin-1-yl]ethanone (PubChem CID 9041261) has the molecular formula C25H32N3O2+ and a molecular weight of 406.55 g/mol. Its IUPAC name is 1-[(3R)-3-(4-benzhydrylpiperazin-4-ium-1-carbonyl)piperidin-1-yl]ethanone.
| Compound Name | 1-[(3R)-3-(4-benzhydrylpiperazin-4-ium-1-carbonyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 9041261 |
| Molecular Formula | C25H32N3O2+ |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 1-[(3R)-3-(4-benzhydrylpiperazin-4-ium-1-carbonyl)piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC[C@@H](C(=O)N2CC[NH+](C(c3ccccc3)c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C25H31N3O2/c1-20(29)28-14-8-13-23(19-28)25(30)27-17-15-26(16-18-27)24(21-9-4-2-5-10-21)22-11-6-3-7-12-22/h2-7,9-12,23-24H,8,13-19H2,1H3/p+1/t23-/m1/s1 |
| InChIKey | PEXPSQKPCGPNHD-HSZRJFAPSA-O |
| XLogP | 1.76 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |