C22H27N2O2+ — CID 7762308
(4-benzhydrylpiperazin-4-ium-1-yl)-[(2S)-oxolan-2-yl]methanone (PubChem CID 7762308) has the molecular formula C22H27N2O2+ and a molecular weight of 351.47 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-4-ium-1-yl)-[(2S)-oxolan-2-yl]methanone.
| Compound Name | (4-benzhydrylpiperazin-4-ium-1-yl)-[(2S)-oxolan-2-yl]methanone |
|---|---|
| PubChem CID | 7762308 |
| Molecular Formula | C22H27N2O2+ |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | (4-benzhydrylpiperazin-4-ium-1-yl)-[(2S)-oxolan-2-yl]methanone |
| SMILES | O=C([C@@H]1CCCO1)N1CC[NH+](C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H26N2O2/c25-22(20-12-7-17-26-20)24-15-13-23(14-16-24)21(18-8-3-1-4-9-18)19-10-5-2-6-11-19/h1-6,8-11,20-21H,7,12-17H2/p+1/t20-/m0/s1 |
| InChIKey | OOXCYJBCWHTHFJ-FQEVSTJZSA-O |
| XLogP | 1.68 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |