C17H21N2O4+ — CID 6925811
(3S)-3-[4-[(2R)-oxolane-2-carbonyl]piperazin-1-ium-1-yl]-3H-2-benzofuran-1-one (PubChem CID 6925811) has the molecular formula C17H21N2O4+ and a molecular weight of 317.36 g/mol. Its IUPAC name is (3S)-3-[4-[(2R)-oxolane-2-carbonyl]piperazin-1-ium-1-yl]-3H-2-benzofuran-1-one.
| Compound Name | (3S)-3-[4-[(2R)-oxolane-2-carbonyl]piperazin-1-ium-1-yl]-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 6925811 |
| Molecular Formula | C17H21N2O4+ |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | (3S)-3-[4-[(2R)-oxolane-2-carbonyl]piperazin-1-ium-1-yl]-3H-2-benzofuran-1-one |
| SMILES | O=C1O[C@H]([NH+]2CCN(C(=O)[C@H]3CCCO3)CC2)c2ccccc21 |
| InChI | InChI=1S/C17H20N2O4/c20-15(14-6-3-11-22-14)18-7-9-19(10-8-18)16-12-4-1-2-5-13(12)17(21)23-16/h1-2,4-5,14,16H,3,6-11H2/p+1/t14-,16+/m1/s1 |
| InChIKey | ACUNJJKADMFOCP-ZBFHGGJFSA-O |
| XLogP | -0.24 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |