C20H23FN2O2S — CID 55573164
[4-[[5-(2-fluorophenyl)thiophen-2-yl]methyl]piperazin-1-yl]-(oxolan-2-yl)methanone (PubChem CID 55573164) has the molecular formula C20H23FN2O2S and a molecular weight of 374.48 g/mol. Its IUPAC name is [4-[[5-(2-fluorophenyl)thiophen-2-yl]methyl]piperazin-1-yl]-(oxolan-2-yl)methanone.
| Compound Name | [4-[[5-(2-fluorophenyl)thiophen-2-yl]methyl]piperazin-1-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 55573164 |
| Molecular Formula | C20H23FN2O2S |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | [4-[[5-(2-fluorophenyl)thiophen-2-yl]methyl]piperazin-1-yl]-(oxolan-2-yl)methanone |
| SMILES | O=C(C1CCCO1)N1CCN(Cc2ccc(-c3ccccc3F)s2)CC1 |
| InChI | InChI=1S/C20H23FN2O2S/c21-17-5-2-1-4-16(17)19-8-7-15(26-19)14-22-9-11-23(12-10-22)20(24)18-6-3-13-25-18/h1-2,4-5,7-8,18H,3,6,9-14H2 |
| InChIKey | VDWAVBUJADFPHT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |