C19H22FN3OS — CID 56808058
N-cyclopropyl-4-[[5-(2-fluorophenyl)thiophen-2-yl]methyl]piperazine-1-carboxamide (PubChem CID 56808058) has the molecular formula C19H22FN3OS and a molecular weight of 359.47 g/mol. Its IUPAC name is N-cyclopropyl-4-[[5-(2-fluorophenyl)thiophen-2-yl]methyl]piperazine-1-carboxamide.
| Compound Name | N-cyclopropyl-4-[[5-(2-fluorophenyl)thiophen-2-yl]methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 56808058 |
| Molecular Formula | C19H22FN3OS |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | N-cyclopropyl-4-[[5-(2-fluorophenyl)thiophen-2-yl]methyl]piperazine-1-carboxamide |
| SMILES | O=C(NC1CC1)N1CCN(Cc2ccc(-c3ccccc3F)s2)CC1 |
| InChI | InChI=1S/C19H22FN3OS/c20-17-4-2-1-3-16(17)18-8-7-15(25-18)13-22-9-11-23(12-10-22)19(24)21-14-5-6-14/h1-4,7-8,14H,5-6,9-13H2,(H,21,24) |
| InChIKey | HRTNLAYVVCIMFI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |