C20H23ClN2O2S — CID 37399558
[4-[[5-(3-chlorophenyl)thiophen-2-yl]methyl]piperazin-1-yl]-[(2R)-oxolan-2-yl]methanone (PubChem CID 37399558) has the molecular formula C20H23ClN2O2S and a molecular weight of 390.94 g/mol. Its IUPAC name is [4-[[5-(3-chlorophenyl)thiophen-2-yl]methyl]piperazin-1-yl]-[(2R)-oxolan-2-yl]methanone.
| Compound Name | [4-[[5-(3-chlorophenyl)thiophen-2-yl]methyl]piperazin-1-yl]-[(2R)-oxolan-2-yl]methanone |
|---|---|
| PubChem CID | 37399558 |
| Molecular Formula | C20H23ClN2O2S |
| Molecular Weight | 390.94 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | [4-[[5-(3-chlorophenyl)thiophen-2-yl]methyl]piperazin-1-yl]-[(2R)-oxolan-2-yl]methanone |
| SMILES | O=C([C@H]1CCCO1)N1CCN(Cc2ccc(-c3cccc(Cl)c3)s2)CC1 |
| InChI | InChI=1S/C20H23ClN2O2S/c21-16-4-1-3-15(13-16)19-7-6-17(26-19)14-22-8-10-23(11-9-22)20(24)18-5-2-12-25-18/h1,3-4,6-7,13,18H,2,5,8-12,14H2/t18-/m1/s1 |
| InChIKey | AGQRSMJTDXWYFJ-GOSISDBHSA-N |
| XLogP | 3.89 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.94 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |