C23H25ClN2O3 — CID 45203674
N-[3-(3-chlorophenyl)phenyl]-1-(oxolane-2-carbonyl)piperidine-4-carboxamide (PubChem CID 45203674) has the molecular formula C23H25ClN2O3 and a molecular weight of 412.92 g/mol. Its IUPAC name is N-[3-(3-chlorophenyl)phenyl]-1-(oxolane-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-[3-(3-chlorophenyl)phenyl]-1-(oxolane-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 45203674 |
| Molecular Formula | C23H25ClN2O3 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-[3-(3-chlorophenyl)phenyl]-1-(oxolane-2-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1cccc(-c2cccc(Cl)c2)c1)C1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C23H25ClN2O3/c24-19-6-1-4-17(14-19)18-5-2-7-20(15-18)25-22(27)16-9-11-26(12-10-16)23(28)21-8-3-13-29-21/h1-2,4-7,14-16,21H,3,8-13H2,(H,25,27) |
| InChIKey | OUYWLNZPILZRCD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |