C18H21ClN4O2 — CID 167937168
[4-[4-(3-chlorophenyl)triazol-1-yl]piperidin-1-yl]-(oxolan-2-yl)methanone (PubChem CID 167937168) has the molecular formula C18H21ClN4O2 and a molecular weight of 360.85 g/mol. Its IUPAC name is [4-[4-(3-chlorophenyl)triazol-1-yl]piperidin-1-yl]-(oxolan-2-yl)methanone.
| Compound Name | [4-[4-(3-chlorophenyl)triazol-1-yl]piperidin-1-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 167937168 |
| Molecular Formula | C18H21ClN4O2 |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | [4-[4-(3-chlorophenyl)triazol-1-yl]piperidin-1-yl]-(oxolan-2-yl)methanone |
| SMILES | O=C(C1CCCO1)N1CCC(n2cc(-c3cccc(Cl)c3)nn2)CC1 |
| InChI | InChI=1S/C18H21ClN4O2/c19-14-4-1-3-13(11-14)16-12-23(21-20-16)15-6-8-22(9-7-15)18(24)17-5-2-10-25-17/h1,3-4,11-12,15,17H,2,5-10H2 |
| InChIKey | HCSDHCZVUQQCPX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |