C16H21FN2O2 — CID 110293021
[3-(2-fluorophenyl)-4-methylpiperazin-1-yl]-(oxolan-2-yl)methanone (PubChem CID 110293021) has the molecular formula C16H21FN2O2 and a molecular weight of 292.35 g/mol. Its IUPAC name is [3-(2-fluorophenyl)-4-methylpiperazin-1-yl]-(oxolan-2-yl)methanone.
| Compound Name | [3-(2-fluorophenyl)-4-methylpiperazin-1-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 110293021 |
| Molecular Formula | C16H21FN2O2 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | [3-(2-fluorophenyl)-4-methylpiperazin-1-yl]-(oxolan-2-yl)methanone |
| SMILES | CN1CCN(C(=O)C2CCCO2)CC1c1ccccc1F |
| InChI | InChI=1S/C16H21FN2O2/c1-18-8-9-19(16(20)15-7-4-10-21-15)11-14(18)12-5-2-3-6-13(12)17/h2-3,5-6,14-15H,4,7-11H2,1H3 |
| InChIKey | AINFSSQYLMEDQI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |