C17H19FN2OS — CID 110293046
1-[3-(2-fluorophenyl)-4-methylpiperazin-1-yl]-2-thiophen-2-ylethanone (PubChem CID 110293046) has the molecular formula C17H19FN2OS and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-[3-(2-fluorophenyl)-4-methylpiperazin-1-yl]-2-thiophen-2-ylethanone.
| Compound Name | 1-[3-(2-fluorophenyl)-4-methylpiperazin-1-yl]-2-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 110293046 |
| Molecular Formula | C17H19FN2OS |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 1-[3-(2-fluorophenyl)-4-methylpiperazin-1-yl]-2-thiophen-2-ylethanone |
| SMILES | CN1CCN(C(=O)Cc2cccs2)CC1c1ccccc1F |
| InChI | InChI=1S/C17H19FN2OS/c1-19-8-9-20(17(21)11-13-5-4-10-22-13)12-16(19)14-6-2-3-7-15(14)18/h2-7,10,16H,8-9,11-12H2,1H3 |
| InChIKey | FWNIESHYSUTAMA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |