C14H23N3O+2 — CID 7145137
[2-oxo-2-[4-[(1S)-1-phenylethyl]piperazin-4-ium-1-yl]ethyl]azanium (PubChem CID 7145137) has the molecular formula C14H23N3O+2 and a molecular weight of 249.36 g/mol. Its IUPAC name is [2-oxo-2-[4-[(1S)-1-phenylethyl]piperazin-4-ium-1-yl]ethyl]azanium.
| Compound Name | [2-oxo-2-[4-[(1S)-1-phenylethyl]piperazin-4-ium-1-yl]ethyl]azanium |
|---|---|
| PubChem CID | 7145137 |
| Molecular Formula | C14H23N3O+2 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | [2-oxo-2-[4-[(1S)-1-phenylethyl]piperazin-4-ium-1-yl]ethyl]azanium |
| SMILES | C[C@@H](c1ccccc1)[NH+]1CCN(C(=O)C[NH3+])CC1 |
| InChI | InChI=1S/C14H21N3O/c1-12(13-5-3-2-4-6-13)16-7-9-17(10-8-16)14(18)11-15/h2-6,12H,7-11,15H2,1H3/p+2/t12-/m0/s1 |
| InChIKey | YRYJXOGSURUVGR-LBPRGKRZSA-P |
| XLogP | -1.28 |
| TPSA | 52.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |