C21H22F3N3O4S — CID 17487848
N-[2-oxo-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]ethyl]-2-phenylacetamide (PubChem CID 17487848) has the molecular formula C21H22F3N3O4S and a molecular weight of 469.49 g/mol. Its IUPAC name is N-[2-oxo-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]ethyl]-2-phenylacetamide.
| Compound Name | N-[2-oxo-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]ethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 17487848 |
| Molecular Formula | C21H22F3N3O4S |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | N-[2-oxo-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]ethyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NCC(=O)N1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C21H22F3N3O4S/c22-21(23,24)17-7-4-8-18(14-17)32(30,31)27-11-9-26(10-12-27)20(29)15-25-19(28)13-16-5-2-1-3-6-16/h1-8,14H,9-13,15H2,(H,25,28) |
| InChIKey | IACBLCGMNXIKCI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |