C26H29N2O2+ — CID 9041223
(4-benzhydrylpiperazin-4-ium-1-yl)-[3-(methoxymethyl)phenyl]methanone (PubChem CID 9041223) has the molecular formula C26H29N2O2+ and a molecular weight of 401.53 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-4-ium-1-yl)-[3-(methoxymethyl)phenyl]methanone.
| Compound Name | (4-benzhydrylpiperazin-4-ium-1-yl)-[3-(methoxymethyl)phenyl]methanone |
|---|---|
| PubChem CID | 9041223 |
| Molecular Formula | C26H29N2O2+ |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | (4-benzhydrylpiperazin-4-ium-1-yl)-[3-(methoxymethyl)phenyl]methanone |
| SMILES | COCc1cccc(C(=O)N2CC[NH+](C(c3ccccc3)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C26H28N2O2/c1-30-20-21-9-8-14-24(19-21)26(29)28-17-15-27(16-18-28)25(22-10-4-2-5-11-22)23-12-6-3-7-13-23/h2-14,19,25H,15-18,20H2,1H3/p+1 |
| InChIKey | UYYHTWCCZQPFJY-UHFFFAOYSA-O |
| XLogP | 2.96 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |