C20H25N2O3S+ — CID 9105671
[4-[(3-methylphenyl)methyl]piperazin-4-ium-1-yl]-(4-methylsulfonylphenyl)methanone (PubChem CID 9105671) has the molecular formula C20H25N2O3S+ and a molecular weight of 373.50 g/mol. Its IUPAC name is [4-[(3-methylphenyl)methyl]piperazin-4-ium-1-yl]-(4-methylsulfonylphenyl)methanone.
| Compound Name | [4-[(3-methylphenyl)methyl]piperazin-4-ium-1-yl]-(4-methylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 9105671 |
| Molecular Formula | C20H25N2O3S+ |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | [4-[(3-methylphenyl)methyl]piperazin-4-ium-1-yl]-(4-methylsulfonylphenyl)methanone |
| SMILES | Cc1cccc(C[NH+]2CCN(C(=O)c3ccc(S(C)(=O)=O)cc3)CC2)c1 |
| InChI | InChI=1S/C20H24N2O3S/c1-16-4-3-5-17(14-16)15-21-10-12-22(13-11-21)20(23)18-6-8-19(9-7-18)26(2,24)25/h3-9,14H,10-13,15H2,1-2H3/p+1 |
| InChIKey | TUWAYSREBYODGZ-UHFFFAOYSA-O |
| XLogP | 0.94 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |