C11H18N3O2S+ — CID 4522638
1-methylsulfonyl-4-(pyridin-3-ylmethyl)piperazin-4-ium (PubChem CID 4522638) has the molecular formula C11H18N3O2S+ and a molecular weight of 256.35 g/mol. Its IUPAC name is 1-methylsulfonyl-4-(pyridin-3-ylmethyl)piperazin-4-ium.
| Compound Name | 1-methylsulfonyl-4-(pyridin-3-ylmethyl)piperazin-4-ium |
|---|---|
| PubChem CID | 4522638 |
| Molecular Formula | C11H18N3O2S+ |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 1-methylsulfonyl-4-(pyridin-3-ylmethyl)piperazin-4-ium |
| SMILES | CS(=O)(=O)N1CC[NH+](Cc2cccnc2)CC1 |
| InChI | InChI=1S/C11H17N3O2S/c1-17(15,16)14-7-5-13(6-8-14)10-11-3-2-4-12-9-11/h2-4,9H,5-8,10H2,1H3/p+1 |
| InChIKey | BLTMPDHZIKQDNY-UHFFFAOYSA-O |
| XLogP | -1.26 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |