C20H25N4O3+ — CID 9226163
N-[2-oxo-2-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]ethyl]-2-phenoxyacetamide (PubChem CID 9226163) has the molecular formula C20H25N4O3+ and a molecular weight of 369.45 g/mol. Its IUPAC name is N-[2-oxo-2-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]ethyl]-2-phenoxyacetamide.
| Compound Name | N-[2-oxo-2-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]ethyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 9226163 |
| Molecular Formula | C20H25N4O3+ |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | N-[2-oxo-2-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]ethyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)NCC(=O)N1CC[NH+](Cc2ccncc2)CC1 |
| InChI | InChI=1S/C20H24N4O3/c25-19(16-27-18-4-2-1-3-5-18)22-14-20(26)24-12-10-23(11-13-24)15-17-6-8-21-9-7-17/h1-9H,10-16H2,(H,22,25)/p+1 |
| InChIKey | NHFXNODASVWFMT-UHFFFAOYSA-O |
| XLogP | -0.50 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |