C24H35N4O2+ — CID 9226367
2-(1-adamantyl)-N-[2-oxo-2-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]ethyl]acetamide (PubChem CID 9226367) has the molecular formula C24H35N4O2+ and a molecular weight of 411.57 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[2-oxo-2-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]ethyl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[2-oxo-2-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 9226367 |
| Molecular Formula | C24H35N4O2+ |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | 2-(1-adamantyl)-N-[2-oxo-2-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]ethyl]acetamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)NCC(=O)N1CC[NH+](Cc2ccncc2)CC1 |
| InChI | InChI=1S/C24H34N4O2/c29-22(15-24-12-19-9-20(13-24)11-21(10-19)14-24)26-16-23(30)28-7-5-27(6-8-28)17-18-1-3-25-4-2-18/h1-4,19-21H,5-17H2,(H,26,29)/p+1 |
| InChIKey | ZSODJIJHXSCRPA-UHFFFAOYSA-O |
| XLogP | 1.03 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |