C25H37N4O2+ — CID 9226701
N-[4-oxo-4-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]butyl]adamantane-1-carboxamide (PubChem CID 9226701) has the molecular formula C25H37N4O2+ and a molecular weight of 425.60 g/mol. Its IUPAC name is N-[4-oxo-4-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]butyl]adamantane-1-carboxamide.
| Compound Name | N-[4-oxo-4-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]butyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 9226701 |
| Molecular Formula | C25H37N4O2+ |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | N-[4-oxo-4-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]butyl]adamantane-1-carboxamide |
| SMILES | O=C(CCCNC(=O)C12CC3CC(CC(C3)C1)C2)N1CC[NH+](Cc2ccncc2)CC1 |
| InChI | InChI=1S/C25H36N4O2/c30-23(29-10-8-28(9-11-29)18-19-3-6-26-7-4-19)2-1-5-27-24(31)25-15-20-12-21(16-25)14-22(13-20)17-25/h3-4,6-7,20-22H,1-2,5,8-18H2,(H,27,31)/p+1 |
| InChIKey | QBGYSSVJPCPYMW-UHFFFAOYSA-O |
| XLogP | 1.42 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|