C24H33N4O2+ — CID 9226273
4-tert-butyl-N-[3-oxo-3-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]propyl]benzamide (PubChem CID 9226273) has the molecular formula C24H33N4O2+ and a molecular weight of 409.55 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-oxo-3-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]propyl]benzamide.
| Compound Name | 4-tert-butyl-N-[3-oxo-3-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]propyl]benzamide |
|---|---|
| PubChem CID | 9226273 |
| Molecular Formula | C24H33N4O2+ |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | 4-tert-butyl-N-[3-oxo-3-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]propyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NCCC(=O)N2CC[NH+](Cc3ccncc3)CC2)cc1 |
| InChI | InChI=1S/C24H32N4O2/c1-24(2,3)21-6-4-20(5-7-21)23(30)26-13-10-22(29)28-16-14-27(15-17-28)18-19-8-11-25-12-9-19/h4-9,11-12H,10,13-18H2,1-3H3,(H,26,30)/p+1 |
| InChIKey | OMPWZJPJVUZTSQ-UHFFFAOYSA-O |
| XLogP | 1.43 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |