C21H25ClN3O2+ — CID 7964636
N-[3-(4-benzylpiperazin-4-ium-1-yl)-3-oxopropyl]-2-chlorobenzamide (PubChem CID 7964636) has the molecular formula C21H25ClN3O2+ and a molecular weight of 386.90 g/mol. Its IUPAC name is N-[3-(4-benzylpiperazin-4-ium-1-yl)-3-oxopropyl]-2-chlorobenzamide.
| Compound Name | N-[3-(4-benzylpiperazin-4-ium-1-yl)-3-oxopropyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 7964636 |
| Molecular Formula | C21H25ClN3O2+ |
| Molecular Weight | 386.90 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | N-[3-(4-benzylpiperazin-4-ium-1-yl)-3-oxopropyl]-2-chlorobenzamide |
| SMILES | O=C(NCCC(=O)N1CC[NH+](Cc2ccccc2)CC1)c1ccccc1Cl |
| InChI | InChI=1S/C21H24ClN3O2/c22-19-9-5-4-8-18(19)21(27)23-11-10-20(26)25-14-12-24(13-15-25)16-17-6-2-1-3-7-17/h1-9H,10-16H2,(H,23,27)/p+1 |
| InChIKey | LHHJQBQRCHCCKJ-UHFFFAOYSA-O |
| XLogP | 1.39 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.90 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |