C23H29N4O3+ — CID 9226275
(E)-3-(4-methoxyphenyl)-N-[3-oxo-3-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]propyl]prop-2-enamide (PubChem CID 9226275) has the molecular formula C23H29N4O3+ and a molecular weight of 409.51 g/mol. Its IUPAC name is (E)-3-(4-methoxyphenyl)-N-[3-oxo-3-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]propyl]prop-2-enamide.
| Compound Name | (E)-3-(4-methoxyphenyl)-N-[3-oxo-3-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 9226275 |
| Molecular Formula | C23H29N4O3+ |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | (E)-3-(4-methoxyphenyl)-N-[3-oxo-3-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]propyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NCCC(=O)N2CC[NH+](Cc3ccncc3)CC2)cc1 |
| InChI | InChI=1S/C23H28N4O3/c1-30-21-5-2-19(3-6-21)4-7-22(28)25-13-10-23(29)27-16-14-26(15-17-27)18-20-8-11-24-12-9-20/h2-9,11-12H,10,13-18H2,1H3,(H,25,28)/p+1/b7-4+ |
| InChIKey | UVTHRXOKMHHORG-QPJJXVBHSA-O |
| XLogP | 0.54 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|