C28H29NO4 — CID 140911738
4-[2-[1-[2-(2-phenylphenoxy)acetyl]piperidin-4-yl]ethyl]benzoic acid (PubChem CID 140911738) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is 4-[2-[1-[2-(2-phenylphenoxy)acetyl]piperidin-4-yl]ethyl]benzoic acid.
| Compound Name | 4-[2-[1-[2-(2-phenylphenoxy)acetyl]piperidin-4-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 140911738 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 4-[2-[1-[2-(2-phenylphenoxy)acetyl]piperidin-4-yl]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCC2CCN(C(=O)COc3ccccc3-c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C28H29NO4/c30-27(20-33-26-9-5-4-8-25(26)23-6-2-1-3-7-23)29-18-16-22(17-19-29)11-10-21-12-14-24(15-13-21)28(31)32/h1-9,12-15,22H,10-11,16-20H2,(H,31,32) |
| InChIKey | XMMLKBIXWSYNDB-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |