C28H31NO3 — CID 140911747
1-[4-[2-[3-(hydroxymethyl)phenyl]ethyl]piperidin-1-yl]-2-(2-phenylphenoxy)ethanone (PubChem CID 140911747) has the molecular formula C28H31NO3 and a molecular weight of 429.56 g/mol. Its IUPAC name is 1-[4-[2-[3-(hydroxymethyl)phenyl]ethyl]piperidin-1-yl]-2-(2-phenylphenoxy)ethanone.
| Compound Name | 1-[4-[2-[3-(hydroxymethyl)phenyl]ethyl]piperidin-1-yl]-2-(2-phenylphenoxy)ethanone |
|---|---|
| PubChem CID | 140911747 |
| Molecular Formula | C28H31NO3 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 1-[4-[2-[3-(hydroxymethyl)phenyl]ethyl]piperidin-1-yl]-2-(2-phenylphenoxy)ethanone |
| SMILES | O=C(COc1ccccc1-c1ccccc1)N1CCC(CCc2cccc(CO)c2)CC1 |
| InChI | InChI=1S/C28H31NO3/c30-20-24-8-6-7-23(19-24)14-13-22-15-17-29(18-16-22)28(31)21-32-27-12-5-4-11-26(27)25-9-2-1-3-10-25/h1-12,19,22,30H,13-18,20-21H2 |
| InChIKey | YJHAIVHSEYHZFI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |