C28H31NO3 — CID 140911765
1-[4-[2-(3-methoxyphenyl)ethyl]piperidin-1-yl]-2-(2-phenylphenoxy)ethanone (PubChem CID 140911765) has the molecular formula C28H31NO3 and a molecular weight of 429.56 g/mol. Its IUPAC name is 1-[4-[2-(3-methoxyphenyl)ethyl]piperidin-1-yl]-2-(2-phenylphenoxy)ethanone.
| Compound Name | 1-[4-[2-(3-methoxyphenyl)ethyl]piperidin-1-yl]-2-(2-phenylphenoxy)ethanone |
|---|---|
| PubChem CID | 140911765 |
| Molecular Formula | C28H31NO3 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 1-[4-[2-(3-methoxyphenyl)ethyl]piperidin-1-yl]-2-(2-phenylphenoxy)ethanone |
| SMILES | COc1cccc(CCC2CCN(C(=O)COc3ccccc3-c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C28H31NO3/c1-31-25-11-7-8-23(20-25)15-14-22-16-18-29(19-17-22)28(30)21-32-27-13-6-5-12-26(27)24-9-3-2-4-10-24/h2-13,20,22H,14-19,21H2,1H3 |
| InChIKey | KXTYEUBEHPFLJL-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |