C38H40N2O4 — CID 140911892
2-[2-(5-isocyano-2-phenylmethoxyphenyl)phenoxy]-1-[4-[2-(3-propan-2-yloxyphenyl)ethyl]piperidin-1-yl]ethanone (PubChem CID 140911892) has the molecular formula C38H40N2O4 and a molecular weight of 588.75 g/mol. Its IUPAC name is 2-[2-(5-isocyano-2-phenylmethoxyphenyl)phenoxy]-1-[4-[2-(3-propan-2-yloxyphenyl)ethyl]piperidin-1-yl]ethanone.
| Compound Name | 2-[2-(5-isocyano-2-phenylmethoxyphenyl)phenoxy]-1-[4-[2-(3-propan-2-yloxyphenyl)ethyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 140911892 |
| Molecular Formula | C38H40N2O4 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.30 |
| IUPAC Name | 2-[2-(5-isocyano-2-phenylmethoxyphenyl)phenoxy]-1-[4-[2-(3-propan-2-yloxyphenyl)ethyl]piperidin-1-yl]ethanone |
| SMILES | [C-]#[N+]c1ccc(OCc2ccccc2)c(-c2ccccc2OCC(=O)N2CCC(CCc3cccc(OC(C)C)c3)CC2)c1 |
| InChI | InChI=1S/C38H40N2O4/c1-28(2)44-33-13-9-12-30(24-33)17-16-29-20-22-40(23-21-29)38(41)27-43-36-15-8-7-14-34(36)35-25-32(39-3)18-19-37(35)42-26-31-10-5-4-6-11-31/h4-15,18-19,24-25,28-29H,16-17,20-23,26-27H2,1-2H3 |
| InChIKey | XCFONYFEKSAHEG-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 52.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|