C20H25N2O2S+ — CID 9069255
5-acetyl-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]thiophene-2-carboxamide (PubChem CID 9069255) has the molecular formula C20H25N2O2S+ and a molecular weight of 357.50 g/mol. Its IUPAC name is 5-acetyl-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]thiophene-2-carboxamide.
| Compound Name | 5-acetyl-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9069255 |
| Molecular Formula | C20H25N2O2S+ |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 5-acetyl-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]thiophene-2-carboxamide |
| SMILES | CC(=O)c1ccc(C(=O)NCc2ccccc2C[NH+]2CCCCC2)s1 |
| InChI | InChI=1S/C20H24N2O2S/c1-15(23)18-9-10-19(25-18)20(24)21-13-16-7-3-4-8-17(16)14-22-11-5-2-6-12-22/h3-4,7-10H,2,5-6,11-14H2,1H3,(H,21,24)/p+1 |
| InChIKey | DGDLDUXDTWYIPD-UHFFFAOYSA-O |
| XLogP | 2.45 |
| TPSA | 50.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |