C19H23BrN3O+ — CID 8968923
5-bromo-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]pyridine-3-carboxamide (PubChem CID 8968923) has the molecular formula C19H23BrN3O+ and a molecular weight of 389.32 g/mol. Its IUPAC name is 5-bromo-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 8968923 |
| Molecular Formula | C19H23BrN3O+ |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 5-bromo-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1C[NH+]1CCCCC1)c1cncc(Br)c1 |
| InChI | InChI=1S/C19H22BrN3O/c20-18-10-17(11-21-13-18)19(24)22-12-15-6-2-3-7-16(15)14-23-8-4-1-5-9-23/h2-3,6-7,10-11,13H,1,4-5,8-9,12,14H2,(H,22,24)/p+1 |
| InChIKey | KJRYZATVGPMIHK-UHFFFAOYSA-O |
| XLogP | 2.34 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |