C21H28N3O4S+ — CID 9143604
3-[methoxy(methyl)sulfamoyl]-N-[[2-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]benzamide (PubChem CID 9143604) has the molecular formula C21H28N3O4S+ and a molecular weight of 418.54 g/mol. Its IUPAC name is 3-[methoxy(methyl)sulfamoyl]-N-[[2-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]benzamide.
| Compound Name | 3-[methoxy(methyl)sulfamoyl]-N-[[2-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 9143604 |
| Molecular Formula | C21H28N3O4S+ |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 3-[methoxy(methyl)sulfamoyl]-N-[[2-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]benzamide |
| SMILES | CON(C)S(=O)(=O)c1cccc(C(=O)NCc2ccccc2C[NH+]2CCCC2)c1 |
| InChI | InChI=1S/C21H27N3O4S/c1-23(28-2)29(26,27)20-11-7-10-17(14-20)21(25)22-15-18-8-3-4-9-19(18)16-24-12-5-6-13-24/h3-4,7-11,14H,5-6,12-13,15-16H2,1-2H3,(H,22,25)/p+1 |
| InChIKey | HQMWSQVCCGBXDN-UHFFFAOYSA-O |
| XLogP | 0.98 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|