C15H22N2O5S2 — CID 125141108
3-[methoxy(methyl)sulfamoyl]-N-[[1-[(S)-methylsulfinyl]cyclobutyl]methyl]benzamide (PubChem CID 125141108) has the molecular formula C15H22N2O5S2 and a molecular weight of 374.48 g/mol. Its IUPAC name is 3-[methoxy(methyl)sulfamoyl]-N-[[1-[(S)-methylsulfinyl]cyclobutyl]methyl]benzamide.
| Compound Name | 3-[methoxy(methyl)sulfamoyl]-N-[[1-[(S)-methylsulfinyl]cyclobutyl]methyl]benzamide |
|---|---|
| PubChem CID | 125141108 |
| Molecular Formula | C15H22N2O5S2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 3-[methoxy(methyl)sulfamoyl]-N-[[1-[(S)-methylsulfinyl]cyclobutyl]methyl]benzamide |
| SMILES | CON(C)S(=O)(=O)c1cccc(C(=O)NCC2([S@](C)=O)CCC2)c1 |
| InChI | InChI=1S/C15H22N2O5S2/c1-17(22-2)24(20,21)13-7-4-6-12(10-13)14(18)16-11-15(23(3)19)8-5-9-15/h4,6-7,10H,5,8-9,11H2,1-3H3,(H,16,18)/t23-/m0/s1 |
| InChIKey | RUKNBCDAHDFWKH-QHCPKHFHSA-N |
| XLogP | 0.90 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|