C20H33N3O4S — CID 55658978
3-[methoxy(methyl)sulfamoyl]-N-[3-methyl-2-(4-methylpiperidin-1-yl)butyl]benzamide (PubChem CID 55658978) has the molecular formula C20H33N3O4S and a molecular weight of 411.57 g/mol. Its IUPAC name is 3-[methoxy(methyl)sulfamoyl]-N-[3-methyl-2-(4-methylpiperidin-1-yl)butyl]benzamide.
| Compound Name | 3-[methoxy(methyl)sulfamoyl]-N-[3-methyl-2-(4-methylpiperidin-1-yl)butyl]benzamide |
|---|---|
| PubChem CID | 55658978 |
| Molecular Formula | C20H33N3O4S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 3-[methoxy(methyl)sulfamoyl]-N-[3-methyl-2-(4-methylpiperidin-1-yl)butyl]benzamide |
| SMILES | CON(C)S(=O)(=O)c1cccc(C(=O)NCC(C(C)C)N2CCC(C)CC2)c1 |
| InChI | InChI=1S/C20H33N3O4S/c1-15(2)19(23-11-9-16(3)10-12-23)14-21-20(24)17-7-6-8-18(13-17)28(25,26)22(4)27-5/h6-8,13,15-16,19H,9-12,14H2,1-5H3,(H,21,24) |
| InChIKey | MMEBRAGNQBGGCY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|