C22H25N4O2+ — CID 9143875
2-(4-oxo-3H-phthalazin-1-yl)-N-[[2-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]acetamide (PubChem CID 9143875) has the molecular formula C22H25N4O2+ and a molecular weight of 377.47 g/mol. Its IUPAC name is 2-(4-oxo-3H-phthalazin-1-yl)-N-[[2-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(4-oxo-3H-phthalazin-1-yl)-N-[[2-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 9143875 |
| Molecular Formula | C22H25N4O2+ |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 2-(4-oxo-3H-phthalazin-1-yl)-N-[[2-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]acetamide |
| SMILES | O=C(Cc1n[nH]c(=O)c2ccccc12)NCc1ccccc1C[NH+]1CCCC1 |
| InChI | InChI=1S/C22H24N4O2/c27-21(13-20-18-9-3-4-10-19(18)22(28)25-24-20)23-14-16-7-1-2-8-17(16)15-26-11-5-6-12-26/h1-4,7-10H,5-6,11-15H2,(H,23,27)(H,25,28)/p+1 |
| InChIKey | FXONBNASHFYUOF-UHFFFAOYSA-O |
| XLogP | 0.96 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |