C14H12N4O2S — CID 171679450
2-(4-oxo-3H-phthalazin-1-yl)-N-(1,3-thiazol-2-ylmethyl)acetamide (PubChem CID 171679450) has the molecular formula C14H12N4O2S and a molecular weight of 300.34 g/mol. Its IUPAC name is 2-(4-oxo-3H-phthalazin-1-yl)-N-(1,3-thiazol-2-ylmethyl)acetamide.
| Compound Name | 2-(4-oxo-3H-phthalazin-1-yl)-N-(1,3-thiazol-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 171679450 |
| Molecular Formula | C14H12N4O2S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 2-(4-oxo-3H-phthalazin-1-yl)-N-(1,3-thiazol-2-ylmethyl)acetamide |
| SMILES | O=C(Cc1n[nH]c(=O)c2ccccc12)NCc1nccs1 |
| InChI | InChI=1S/C14H12N4O2S/c19-12(16-8-13-15-5-6-21-13)7-11-9-3-1-2-4-10(9)14(20)18-17-11/h1-6H,7-8H2,(H,16,19)(H,18,20) |
| InChIKey | CSWHTHRGZPWMPW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |