C17H15N3O4S — CID 7789692
[2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-(4-oxo-3H-phthalazin-1-yl)acetate (PubChem CID 7789692) has the molecular formula C17H15N3O4S and a molecular weight of 357.39 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-(4-oxo-3H-phthalazin-1-yl)acetate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-(4-oxo-3H-phthalazin-1-yl)acetate |
|---|---|
| PubChem CID | 7789692 |
| Molecular Formula | C17H15N3O4S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-(4-oxo-3H-phthalazin-1-yl)acetate |
| SMILES | O=C(COC(=O)Cc1n[nH]c(=O)c2ccccc12)NCc1cccs1 |
| InChI | InChI=1S/C17H15N3O4S/c21-15(18-9-11-4-3-7-25-11)10-24-16(22)8-14-12-5-1-2-6-13(12)17(23)20-19-14/h1-7H,8-10H2,(H,18,21)(H,20,23) |
| InChIKey | ZNWSPIZLBNIUBY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |