C20H18N4O5 — CID 7251322
[2-(benzylcarbamoylamino)-2-oxoethyl] 2-(4-oxo-3H-phthalazin-1-yl)acetate (PubChem CID 7251322) has the molecular formula C20H18N4O5 and a molecular weight of 394.39 g/mol. Its IUPAC name is [2-(benzylcarbamoylamino)-2-oxoethyl] 2-(4-oxo-3H-phthalazin-1-yl)acetate.
| Compound Name | [2-(benzylcarbamoylamino)-2-oxoethyl] 2-(4-oxo-3H-phthalazin-1-yl)acetate |
|---|---|
| PubChem CID | 7251322 |
| Molecular Formula | C20H18N4O5 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | [2-(benzylcarbamoylamino)-2-oxoethyl] 2-(4-oxo-3H-phthalazin-1-yl)acetate |
| SMILES | O=C(COC(=O)Cc1n[nH]c(=O)c2ccccc12)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C20H18N4O5/c25-17(22-20(28)21-11-13-6-2-1-3-7-13)12-29-18(26)10-16-14-8-4-5-9-15(14)19(27)24-23-16/h1-9H,10-12H2,(H,24,27)(H2,21,22,25,28) |
| InChIKey | MNTAGKQQLUHHHE-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |