C23H27N2O3+ — CID 8969012
(E)-3-(1,3-benzodioxol-5-yl)-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]prop-2-enamide (PubChem CID 8969012) has the molecular formula C23H27N2O3+ and a molecular weight of 379.48 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 8969012 |
| Molecular Formula | C23H27N2O3+ |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)NCc1ccccc1C[NH+]1CCCCC1 |
| InChI | InChI=1S/C23H26N2O3/c26-23(11-9-18-8-10-21-22(14-18)28-17-27-21)24-15-19-6-2-3-7-20(19)16-25-12-4-1-5-13-25/h2-3,6-11,14H,1,4-5,12-13,15-17H2,(H,24,26)/p+1/b11-9+ |
| InChIKey | XMSKPTJDTSMTOL-PKNBQFBNSA-O |
| XLogP | 2.31 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|