C21H24BrN2O2+ — CID 9481446
(E)-3-(4-bromophenyl)-N-[[2-(morpholin-4-ium-4-ylmethyl)phenyl]methyl]prop-2-enamide (PubChem CID 9481446) has the molecular formula C21H24BrN2O2+ and a molecular weight of 416.34 g/mol. Its IUPAC name is (E)-3-(4-bromophenyl)-N-[[2-(morpholin-4-ium-4-ylmethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(4-bromophenyl)-N-[[2-(morpholin-4-ium-4-ylmethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 9481446 |
| Molecular Formula | C21H24BrN2O2+ |
| Molecular Weight | 416.34 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | (E)-3-(4-bromophenyl)-N-[[2-(morpholin-4-ium-4-ylmethyl)phenyl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Br)cc1)NCc1ccccc1C[NH+]1CCOCC1 |
| InChI | InChI=1S/C21H23BrN2O2/c22-20-8-5-17(6-9-20)7-10-21(25)23-15-18-3-1-2-4-19(18)16-24-11-13-26-14-12-24/h1-10H,11-16H2,(H,23,25)/p+1/b10-7+ |
| InChIKey | MPBHWOBDIRWGRC-JXMROGBWSA-O |
| XLogP | 2.19 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|