C26H29N2O2+ — CID 9209104
N-[[2-(morpholin-4-ium-4-ylmethyl)phenyl]methyl]-2,2-diphenylacetamide (PubChem CID 9209104) has the molecular formula C26H29N2O2+ and a molecular weight of 401.53 g/mol. Its IUPAC name is N-[[2-(morpholin-4-ium-4-ylmethyl)phenyl]methyl]-2,2-diphenylacetamide.
| Compound Name | N-[[2-(morpholin-4-ium-4-ylmethyl)phenyl]methyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 9209104 |
| Molecular Formula | C26H29N2O2+ |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | N-[[2-(morpholin-4-ium-4-ylmethyl)phenyl]methyl]-2,2-diphenylacetamide |
| SMILES | O=C(NCc1ccccc1C[NH+]1CCOCC1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H28N2O2/c29-26(25(21-9-3-1-4-10-21)22-11-5-2-6-12-22)27-19-23-13-7-8-14-24(23)20-28-15-17-30-18-16-28/h1-14,25H,15-20H2,(H,27,29)/p+1 |
| InChIKey | OPSOXIOBEHZXCT-UHFFFAOYSA-O |
| XLogP | 2.55 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |