C20H25N2O2S+ — CID 9481514
(E)-3-(3-methylthiophen-2-yl)-N-[[2-(morpholin-4-ium-4-ylmethyl)phenyl]methyl]prop-2-enamide (PubChem CID 9481514) has the molecular formula C20H25N2O2S+ and a molecular weight of 357.50 g/mol. Its IUPAC name is (E)-3-(3-methylthiophen-2-yl)-N-[[2-(morpholin-4-ium-4-ylmethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(3-methylthiophen-2-yl)-N-[[2-(morpholin-4-ium-4-ylmethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 9481514 |
| Molecular Formula | C20H25N2O2S+ |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | (E)-3-(3-methylthiophen-2-yl)-N-[[2-(morpholin-4-ium-4-ylmethyl)phenyl]methyl]prop-2-enamide |
| SMILES | Cc1ccsc1/C=C/C(=O)NCc1ccccc1C[NH+]1CCOCC1 |
| InChI | InChI=1S/C20H24N2O2S/c1-16-8-13-25-19(16)6-7-20(23)21-14-17-4-2-3-5-18(17)15-22-9-11-24-12-10-22/h2-8,13H,9-12,14-15H2,1H3,(H,21,23)/p+1/b7-6+ |
| InChIKey | OMKDVZNPEBWLRP-VOTSOKGWSA-O |
| XLogP | 1.80 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|