C21H27N2OS+ — CID 8546096
(E)-3-(3-methylthiophen-2-yl)-N-[[4-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]prop-2-enamide (PubChem CID 8546096) has the molecular formula C21H27N2OS+ and a molecular weight of 355.53 g/mol. Its IUPAC name is (E)-3-(3-methylthiophen-2-yl)-N-[[4-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(3-methylthiophen-2-yl)-N-[[4-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 8546096 |
| Molecular Formula | C21H27N2OS+ |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | (E)-3-(3-methylthiophen-2-yl)-N-[[4-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]prop-2-enamide |
| SMILES | Cc1ccsc1/C=C/C(=O)NCc1ccc(C[NH+]2CCCCC2)cc1 |
| InChI | InChI=1S/C21H26N2OS/c1-17-11-14-25-20(17)9-10-21(24)22-15-18-5-7-19(8-6-18)16-23-12-3-2-4-13-23/h5-11,14H,2-4,12-13,15-16H2,1H3,(H,22,24)/p+1/b10-9+ |
| InChIKey | SQEDUQAGXAIPRG-MDZDMXLPSA-O |
| XLogP | 2.95 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|