C20H24N2OS — CID 9143238
(E)-3-(3-methylthiophen-2-yl)-N-[[2-(pyrrolidin-1-ylmethyl)phenyl]methyl]prop-2-enamide (PubChem CID 9143238) has the molecular formula C20H24N2OS and a molecular weight of 340.49 g/mol. Its IUPAC name is (E)-3-(3-methylthiophen-2-yl)-N-[[2-(pyrrolidin-1-ylmethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(3-methylthiophen-2-yl)-N-[[2-(pyrrolidin-1-ylmethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 9143238 |
| Molecular Formula | C20H24N2OS |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | (E)-3-(3-methylthiophen-2-yl)-N-[[2-(pyrrolidin-1-ylmethyl)phenyl]methyl]prop-2-enamide |
| SMILES | Cc1ccsc1/C=C/C(=O)NCc1ccccc1CN1CCCC1 |
| InChI | InChI=1S/C20H24N2OS/c1-16-10-13-24-19(16)8-9-20(23)21-14-17-6-2-3-7-18(17)15-22-11-4-5-12-22/h2-3,6-10,13H,4-5,11-12,14-15H2,1H3,(H,21,23)/b9-8+ |
| InChIKey | VGNCLLILJKRRHT-CMDGGOBGSA-N |
| XLogP | 3.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|