C21H27N2O3+ — CID 9481322
4-(methoxymethyl)-N-[[2-(morpholin-4-ium-4-ylmethyl)phenyl]methyl]benzamide (PubChem CID 9481322) has the molecular formula C21H27N2O3+ and a molecular weight of 355.46 g/mol. Its IUPAC name is 4-(methoxymethyl)-N-[[2-(morpholin-4-ium-4-ylmethyl)phenyl]methyl]benzamide.
| Compound Name | 4-(methoxymethyl)-N-[[2-(morpholin-4-ium-4-ylmethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 9481322 |
| Molecular Formula | C21H27N2O3+ |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 4-(methoxymethyl)-N-[[2-(morpholin-4-ium-4-ylmethyl)phenyl]methyl]benzamide |
| SMILES | COCc1ccc(C(=O)NCc2ccccc2C[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C21H26N2O3/c1-25-16-17-6-8-18(9-7-17)21(24)22-14-19-4-2-3-5-20(19)15-23-10-12-26-13-11-23/h2-9H,10-16H2,1H3,(H,22,24)/p+1 |
| InChIKey | PUEPUQNDLWBDDP-UHFFFAOYSA-O |
| XLogP | 1.18 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |