C13H20N4O4 — CID 119779724
N-[4-(carbamoylamino)-3-methoxyphenyl]-2-(2-methoxyethylamino)acetamide (PubChem CID 119779724) has the molecular formula C13H20N4O4 and a molecular weight of 296.33 g/mol. Its IUPAC name is N-[4-(carbamoylamino)-3-methoxyphenyl]-2-(2-methoxyethylamino)acetamide.
| Compound Name | N-[4-(carbamoylamino)-3-methoxyphenyl]-2-(2-methoxyethylamino)acetamide |
|---|---|
| PubChem CID | 119779724 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | N-[4-(carbamoylamino)-3-methoxyphenyl]-2-(2-methoxyethylamino)acetamide |
| SMILES | COCCNCC(=O)Nc1ccc(NC(N)=O)c(OC)c1 |
| InChI | InChI=1S/C13H20N4O4/c1-20-6-5-15-8-12(18)16-9-3-4-10(17-13(14)19)11(7-9)21-2/h3-4,7,15H,5-6,8H2,1-2H3,(H,16,18)(H3,14,17,19) |
| InChIKey | PUPKBNWABHQDOE-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|