C12H17Cl2N3O3 — CID 119711591
2-chloro-5-[[2-(2-methoxyethylamino)acetyl]amino]benzamide;hydrochloride (PubChem CID 119711591) has the molecular formula C12H17Cl2N3O3 and a molecular weight of 322.19 g/mol. Its IUPAC name is 2-chloro-5-[[2-(2-methoxyethylamino)acetyl]amino]benzamide;hydrochloride.
| Compound Name | 2-chloro-5-[[2-(2-methoxyethylamino)acetyl]amino]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119711591 |
| Molecular Formula | C12H17Cl2N3O3 |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 2-chloro-5-[[2-(2-methoxyethylamino)acetyl]amino]benzamide;hydrochloride |
| SMILES | COCCNCC(=O)Nc1ccc(Cl)c(C(N)=O)c1.Cl |
| InChI | InChI=1S/C12H16ClN3O3.ClH/c1-19-5-4-15-7-11(17)16-8-2-3-10(13)9(6-8)12(14)18;/h2-3,6,15H,4-5,7H2,1H3,(H2,14,18)(H,16,17);1H |
| InChIKey | SPHPUMOIHOCCTN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|