C15H24ClN3O3 — CID 119808622
5-[[2-(2-methoxyethylamino)acetyl]amino]-N,N,2-trimethylbenzamide;hydrochloride (PubChem CID 119808622) has the molecular formula C15H24ClN3O3 and a molecular weight of 329.83 g/mol. Its IUPAC name is 5-[[2-(2-methoxyethylamino)acetyl]amino]-N,N,2-trimethylbenzamide;hydrochloride.
| Compound Name | 5-[[2-(2-methoxyethylamino)acetyl]amino]-N,N,2-trimethylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119808622 |
| Molecular Formula | C15H24ClN3O3 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 5-[[2-(2-methoxyethylamino)acetyl]amino]-N,N,2-trimethylbenzamide;hydrochloride |
| SMILES | COCCNCC(=O)Nc1ccc(C)c(C(=O)N(C)C)c1.Cl |
| InChI | InChI=1S/C15H23N3O3.ClH/c1-11-5-6-12(9-13(11)15(20)18(2)3)17-14(19)10-16-7-8-21-4;/h5-6,9,16H,7-8,10H2,1-4H3,(H,17,19);1H |
| InChIKey | UTDMQSPAYPHBKQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|