C15H22N2O4S — CID 97456217
(E)-N-[4-(ethylsulfonylamino)-3-methoxyphenyl]-2-methylpent-2-enamide (PubChem CID 97456217) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is (E)-N-[4-(ethylsulfonylamino)-3-methoxyphenyl]-2-methylpent-2-enamide.
| Compound Name | (E)-N-[4-(ethylsulfonylamino)-3-methoxyphenyl]-2-methylpent-2-enamide |
|---|---|
| PubChem CID | 97456217 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (E)-N-[4-(ethylsulfonylamino)-3-methoxyphenyl]-2-methylpent-2-enamide |
| SMILES | CC/C=C(\C)C(=O)Nc1ccc(NS(=O)(=O)CC)c(OC)c1 |
| InChI | InChI=1S/C15H22N2O4S/c1-5-7-11(3)15(18)16-12-8-9-13(14(10-12)21-4)17-22(19,20)6-2/h7-10,17H,5-6H2,1-4H3,(H,16,18)/b11-7+ |
| InChIKey | WWTZAOZFETUDRC-YRNVUSSQSA-N |
| XLogP | 2.75 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|