C20H21Cl2FN2O3S — CID 16563331
2,4-dichloro-N-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]-5-fluorobenzamide (PubChem CID 16563331) has the molecular formula C20H21Cl2FN2O3S and a molecular weight of 459.37 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]-5-fluorobenzamide.
| Compound Name | 2,4-dichloro-N-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]-5-fluorobenzamide |
|---|---|
| PubChem CID | 16563331 |
| Molecular Formula | C20H21Cl2FN2O3S |
| Molecular Weight | 459.37 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | 2,4-dichloro-N-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]-5-fluorobenzamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1ccc(NC(=O)c2cc(F)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C20H21Cl2FN2O3S/c1-25(14-5-3-2-4-6-14)29(27,28)15-9-7-13(8-10-15)24-20(26)16-11-19(23)18(22)12-17(16)21/h7-12,14H,2-6H2,1H3,(H,24,26) |
| InChIKey | IVRSQCCUYPHDHA-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.37 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|