C20H24FN3O3S — CID 8781350
2-fluoro-N-[4-[methyl-(1-methylpiperidin-4-yl)sulfamoyl]phenyl]benzamide (PubChem CID 8781350) has the molecular formula C20H24FN3O3S and a molecular weight of 405.50 g/mol. Its IUPAC name is 2-fluoro-N-[4-[methyl-(1-methylpiperidin-4-yl)sulfamoyl]phenyl]benzamide.
| Compound Name | 2-fluoro-N-[4-[methyl-(1-methylpiperidin-4-yl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 8781350 |
| Molecular Formula | C20H24FN3O3S |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 2-fluoro-N-[4-[methyl-(1-methylpiperidin-4-yl)sulfamoyl]phenyl]benzamide |
| SMILES | CN1CCC(N(C)S(=O)(=O)c2ccc(NC(=O)c3ccccc3F)cc2)CC1 |
| InChI | InChI=1S/C20H24FN3O3S/c1-23-13-11-16(12-14-23)24(2)28(26,27)17-9-7-15(8-10-17)22-20(25)18-5-3-4-6-19(18)21/h3-10,16H,11-14H2,1-2H3,(H,22,25) |
| InChIKey | APIDFLMWGASETC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |