C15H15FN2O3S2 — CID 174855973
N-[5-[cyclopropyl(methyl)sulfamoyl]thiophen-2-yl]-2-fluorobenzamide (PubChem CID 174855973) has the molecular formula C15H15FN2O3S2 and a molecular weight of 354.43 g/mol. Its IUPAC name is N-[5-[cyclopropyl(methyl)sulfamoyl]thiophen-2-yl]-2-fluorobenzamide.
| Compound Name | N-[5-[cyclopropyl(methyl)sulfamoyl]thiophen-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 174855973 |
| Molecular Formula | C15H15FN2O3S2 |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | N-[5-[cyclopropyl(methyl)sulfamoyl]thiophen-2-yl]-2-fluorobenzamide |
| SMILES | CN(C1CC1)S(=O)(=O)c1ccc(NC(=O)c2ccccc2F)s1 |
| InChI | InChI=1S/C15H15FN2O3S2/c1-18(10-6-7-10)23(20,21)14-9-8-13(22-14)17-15(19)11-4-2-3-5-12(11)16/h2-5,8-10H,6-7H2,1H3,(H,17,19) |
| InChIKey | BHUGBLCWJOVENS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |