C27H34N2O5S — CID 18883681
[2-[[4-(dicyclohexylsulfamoyl)phenyl]carbamoyl]phenyl] acetate (PubChem CID 18883681) has the molecular formula C27H34N2O5S and a molecular weight of 498.65 g/mol. Its IUPAC name is [2-[[4-(dicyclohexylsulfamoyl)phenyl]carbamoyl]phenyl] acetate.
| Compound Name | [2-[[4-(dicyclohexylsulfamoyl)phenyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 18883681 |
| Molecular Formula | C27H34N2O5S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | [2-[[4-(dicyclohexylsulfamoyl)phenyl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(=O)Nc1ccc(S(=O)(=O)N(C2CCCCC2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C27H34N2O5S/c1-20(30)34-26-15-9-8-14-25(26)27(31)28-21-16-18-24(19-17-21)35(32,33)29(22-10-4-2-5-11-22)23-12-6-3-7-13-23/h8-9,14-19,22-23H,2-7,10-13H2,1H3,(H,28,31) |
| InChIKey | IJLUKXKREDIHEA-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|