C23H29BrN2O5S — CID 17357269
5-bromo-N-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]-2-(2-methoxyethoxy)benzamide (PubChem CID 17357269) has the molecular formula C23H29BrN2O5S and a molecular weight of 525.47 g/mol. Its IUPAC name is 5-bromo-N-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]-2-(2-methoxyethoxy)benzamide.
| Compound Name | 5-bromo-N-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]-2-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17357269 |
| Molecular Formula | C23H29BrN2O5S |
| Molecular Weight | 525.47 g/mol |
| Exact Mass | 524.10 |
| IUPAC Name | 5-bromo-N-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]-2-(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1ccc(Br)cc1C(=O)Nc1ccc(S(=O)(=O)N(C)C2CCCCC2)cc1 |
| InChI | InChI=1S/C23H29BrN2O5S/c1-26(19-6-4-3-5-7-19)32(28,29)20-11-9-18(10-12-20)25-23(27)21-16-17(24)8-13-22(21)31-15-14-30-2/h8-13,16,19H,3-7,14-15H2,1-2H3,(H,25,27) |
| InChIKey | VONUENJOLHAAHN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|